C21H37N6O6+ — CID 173315979
2-[4-[3-methyl-3-[1-[N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]piperidin-4-yl]-2-oxo-1,3-oxazolidin-3-ium-5-yl]piperazin-1-yl]acetic acid (PubChem CID 173315979) has the molecular formula C21H37N6O6+ and a molecular weight of 469.56 g/mol. Its IUPAC name is 2-[4-[3-methyl-3-[1-[N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]piperidin-4-yl]-2-oxo-1,3-oxazolidin-3-ium-5-yl]piperazin-1-yl]acetic acid.
| Compound Name | 2-[4-[3-methyl-3-[1-[N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]piperidin-4-yl]-2-oxo-1,3-oxazolidin-3-ium-5-yl]piperazin-1-yl]acetic acid |
|---|---|
| PubChem CID | 173315979 |
| Molecular Formula | C21H37N6O6+ |
| Molecular Weight | 469.56 g/mol |
| Exact Mass | 469.28 |
| IUPAC Name | 2-[4-[3-methyl-3-[1-[N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]piperidin-4-yl]-2-oxo-1,3-oxazolidin-3-ium-5-yl]piperazin-1-yl]acetic acid |
| SMILES | [H]/N=C(\NC(=O)OC(C)(C)C)N1CCC([N+]2(C)CC(N3CCN(CC(=O)O)CC3)OC2=O)CC1 |
| InChI | InChI=1S/C21H36N6O6/c1-21(2,3)33-19(30)23-18(22)26-7-5-15(6-8-26)27(4)14-16(32-20(27)31)25-11-9-24(10-12-25)13-17(28)29/h15-16H,5-14H2,1-4H3,(H2-,22,23,28,29,30)/p+1 |
| InChIKey | SODGPOLZGJRAAP-UHFFFAOYSA-O |
| XLogP | 0.54 |
| TPSA | 135.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.56 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|