C19H30ClSiZr- — CID 173316338
bis(2,4,5-trimethylcyclopenta-1,3-dien-1-yl)methyl-dimethylsilane;zirconium;hydrochloride (PubChem CID 173316338) has the molecular formula C19H30ClSiZr- and a molecular weight of 413.21 g/mol. Its IUPAC name is bis(2,4,5-trimethylcyclopenta-1,3-dien-1-yl)methyl-dimethylsilane;zirconium;hydrochloride.
| Compound Name | bis(2,4,5-trimethylcyclopenta-1,3-dien-1-yl)methyl-dimethylsilane;zirconium;hydrochloride |
|---|---|
| PubChem CID | 173316338 |
| Molecular Formula | C19H30ClSiZr- |
| Molecular Weight | 413.21 g/mol |
| Exact Mass | 411.09 |
| IUPAC Name | bis(2,4,5-trimethylcyclopenta-1,3-dien-1-yl)methyl-dimethylsilane;zirconium;hydrochloride |
| SMILES | CC1=CC(C)=C([C-](C2=C(C)C=C(C)C2C)[SiH](C)C)C1C.Cl.[Zr] |
| InChI | InChI=1S/C19H29Si.ClH.Zr/c1-11-9-13(3)17(15(11)5)19(20(7)8)18-14(4)10-12(2)16(18)6;;/h9-10,15-16,20H,1-8H3;1H;/q-1;; |
| InChIKey | BQUUNLNYQUZIOU-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.21 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|