About 1-(6-acetyl-2,3-diethyl-4-hydroperoxyphenyl)-4-piperidin-4-ylpiperazin-2-one
1-(6-acetyl-2,3-diethyl-4-hydroperoxyphenyl)-4-piperidin-4-ylpiperazin-2-one (PubChem CID 173316684) has the molecular formula C21H31N3O4
and a molecular weight of 389.50 g/mol. Its IUPAC name is 1-(6-acetyl-2,3-diethyl-4-hydroperoxyphenyl)-4-piperidin-4-ylpiperazin-2-one.
Molecular Properties
| Compound Name | 1-(6-acetyl-2,3-diethyl-4-hydroperoxyphenyl)-4-piperidin-4-ylpiperazin-2-one |
| PubChem CID | 173316684 |
| Molecular Formula | C21H31N3O4 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.23 |
| IUPAC Name | 1-(6-acetyl-2,3-diethyl-4-hydroperoxyphenyl)-4-piperidin-4-ylpiperazin-2-one |
| SMILES | CCc1c(OO)cc(C(C)=O)c(N2CCN(C3CCNCC3)CC2=O)c1CC |
| InChI | InChI=1S/C21H31N3O4/c1-4-16-17(5-2)21(18(14(3)25)12-19(16)28-27)24-11-10-23(13-20(24)26)15-6-8-22-9-7-15/h12,15,22,27H,4-11,13H2,1-3H3 |
| InChIKey | PPGFBUBWYXONJO-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 1-(6-acetyl-2,3-diethyl-4-hydroperoxyphenyl)-4-piperidin-4-ylpiperazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(6-acetyl-2,3-diethyl-4-hydroperoxyphenyl)-4-piperidin-4-ylpiperazin-2-one?
The IUPAC name of 1-(6-acetyl-2,3-diethyl-4-hydroperoxyphenyl)-4-piperidin-4-ylpiperazin-2-one (CID 173316684) is 1-(6-acetyl-2,3-diethyl-4-hydroperoxyphenyl)-4-piperidin-4-ylpiperazin-2-one.
What is the SMILES notation for 1-(6-acetyl-2,3-diethyl-4-hydroperoxyphenyl)-4-piperidin-4-ylpiperazin-2-one?
The canonical SMILES for 1-(6-acetyl-2,3-diethyl-4-hydroperoxyphenyl)-4-piperidin-4-ylpiperazin-2-one is CCc1c(OO)cc(C(C)=O)c(N2CCN(C3CCNCC3)CC2=O)c1CC.
What is the InChIKey of 1-(6-acetyl-2,3-diethyl-4-hydroperoxyphenyl)-4-piperidin-4-ylpiperazin-2-one?
The InChIKey is PPGFBUBWYXONJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H31N3O4/c1-4-16-17(5-2)21(18(14(3)25)12-19(16)28-27)24-11-10-23(13-20(24)26)15-6-8-22-9-7-15/h12,15,22,27H,4-11,13H2,1-3H3.
What are the key properties of 1-(6-acetyl-2,3-diethyl-4-hydroperoxyphenyl)-4-piperidin-4-ylpiperazin-2-one?
1-(6-acetyl-2,3-diethyl-4-hydroperoxyphenyl)-4-piperidin-4-ylpiperazin-2-one has a molecular weight of 389.50 g/mol, XLogP of 2.27, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(6-acetyl-2,3-diethyl-4-hydroperoxyphenyl)-4-piperidin-4-ylpiperazin-2-one is sourced from PubChem (CID 173316684), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).