C16H8 — CID 173317779
pentacyclo[7.5.1.110,14.02,7.04,12]hexadeca-1,3,5,7,9(15),10(16),11,13-octaene (PubChem CID 173317779) has the molecular formula C16H8 and a molecular weight of 200.24 g/mol. Its IUPAC name is pentacyclo[7.5.1.110,14.02,7.04,12]hexadeca-1,3,5,7,9(15),10(16),11,13-octaene.
| Compound Name | pentacyclo[7.5.1.110,14.02,7.04,12]hexadeca-1,3,5,7,9(15),10(16),11,13-octaene |
|---|---|
| PubChem CID | 173317779 |
| Molecular Formula | C16H8 |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.06 |
| IUPAC Name | pentacyclo[7.5.1.110,14.02,7.04,12]hexadeca-1,3,5,7,9(15),10(16),11,13-octaene |
| SMILES | c1cc2cc3cc4c5cc(cc3c5)-c1cc24 |
| InChI | InChI=1S/C16H8/c1-2-10-3-13-8-16-14-5-11(4-12(13)6-14)9(1)7-15(10)16/h1-8H |
| InChIKey | PSCRQHHKCTYDKX-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |