About sodium;1,4-bis(2-acetylhexoxy)-1,4-dioxobutane-2-sulfonic acid;hydride
sodium;1,4-bis(2-acetylhexoxy)-1,4-dioxobutane-2-sulfonic acid;hydride (PubChem CID 173318279) has the molecular formula C20H35NaO9S
and a molecular weight of 474.55 g/mol. Its IUPAC name is sodium;1,4-bis(2-acetylhexoxy)-1,4-dioxobutane-2-sulfonic acid;hydride.
Molecular Properties
| Compound Name | sodium;1,4-bis(2-acetylhexoxy)-1,4-dioxobutane-2-sulfonic acid;hydride |
| PubChem CID | 173318279 |
| Molecular Formula | C20H35NaO9S |
| Molecular Weight | 474.55 g/mol |
| Exact Mass | 474.19 |
| IUPAC Name | sodium;1,4-bis(2-acetylhexoxy)-1,4-dioxobutane-2-sulfonic acid;hydride |
| SMILES | CCCCC(COC(=O)CC(C(=O)OCC(CCCC)C(C)=O)S(=O)(=O)O)C(C)=O.[H-].[Na+] |
| InChI | InChI=1S/C20H34O9S.Na.H/c1-5-7-9-16(14(3)21)12-28-19(23)11-18(30(25,26)27)20(24)29-13-17(15(4)22)10-8-6-2;;/h16-18H,5-13H2,1-4H3,(H,25,26,27);;/q;+1;-1 |
| InChIKey | PUNDFZGVGLQUJA-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 141.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 474.55 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze sodium;1,4-bis(2-acetylhexoxy)-1,4-dioxobutane-2-sulfonic acid;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;1,4-bis(2-acetylhexoxy)-1,4-dioxobutane-2-sulfonic acid;hydride?
The IUPAC name of sodium;1,4-bis(2-acetylhexoxy)-1,4-dioxobutane-2-sulfonic acid;hydride (CID 173318279) is sodium;1,4-bis(2-acetylhexoxy)-1,4-dioxobutane-2-sulfonic acid;hydride.
What is the SMILES notation for sodium;1,4-bis(2-acetylhexoxy)-1,4-dioxobutane-2-sulfonic acid;hydride?
The canonical SMILES for sodium;1,4-bis(2-acetylhexoxy)-1,4-dioxobutane-2-sulfonic acid;hydride is CCCCC(COC(=O)CC(C(=O)OCC(CCCC)C(C)=O)S(=O)(=O)O)C(C)=O.[H-].[Na+].
What is the InChIKey of sodium;1,4-bis(2-acetylhexoxy)-1,4-dioxobutane-2-sulfonic acid;hydride?
The InChIKey is PUNDFZGVGLQUJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H34O9S.Na.H/c1-5-7-9-16(14(3)21)12-28-19(23)11-18(30(25,26)27)20(24)29-13-17(15(4)22)10-8-6-2;;/h16-18H,5-13H2,1-4H3,(H,25,26,27);;/q;+1;-1.
What are the key properties of sodium;1,4-bis(2-acetylhexoxy)-1,4-dioxobutane-2-sulfonic acid;hydride?
sodium;1,4-bis(2-acetylhexoxy)-1,4-dioxobutane-2-sulfonic acid;hydride has a molecular weight of 474.55 g/mol, XLogP of -0.37, 16 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;1,4-bis(2-acetylhexoxy)-1,4-dioxobutane-2-sulfonic acid;hydride is sourced from PubChem (CID 173318279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).