About CID 173318414
CID 173318414 (PubChem CID 173318414) has the molecular formula C13H28NSn
and a molecular weight of 317.09 g/mol.
Molecular Properties
| Compound Name | CID 173318414 |
| PubChem CID | 173318414 |
| Molecular Formula | C13H28NSn |
| Molecular Weight | 317.09 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | — |
| SMILES | C#N.CC(C)C[Sn](CC(C)C)CC(C)C |
| InChI | InChI=1S/3C4H9.CHN.Sn/c3*1-4(2)3;1-2;/h3*4H,1H2,2-3H3;1H; |
| InChIKey | WXLILDBWDKZCRV-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.09 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze CID 173318414 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 173318414?
The IUPAC name of CID 173318414 (CID 173318414) is not available.
What is the SMILES notation for CID 173318414?
The canonical SMILES for CID 173318414 is C#N.CC(C)C[Sn](CC(C)C)CC(C)C.
What is the InChIKey of CID 173318414?
The InChIKey is WXLILDBWDKZCRV-UHFFFAOYSA-N. The full InChI is InChI=1S/3C4H9.CHN.Sn/c3*1-4(2)3;1-2;/h3*4H,1H2,2-3H3;1H;.
What are the key properties of CID 173318414?
CID 173318414 has a molecular weight of 317.09 g/mol, XLogP of 4.59, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 173318414 is sourced from PubChem (CID 173318414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).