C12H20ClN — CID 17331855
N-[(4-propan-2-ylphenyl)methyl]ethanamine;hydrochloride (PubChem CID 17331855) has the molecular formula C12H20ClN and a molecular weight of 213.75 g/mol. Its IUPAC name is N-[(4-propan-2-ylphenyl)methyl]ethanamine;hydrochloride.
| Compound Name | N-[(4-propan-2-ylphenyl)methyl]ethanamine;hydrochloride |
|---|---|
| PubChem CID | 17331855 |
| Molecular Formula | C12H20ClN |
| Molecular Weight | 213.75 g/mol |
| Exact Mass | 213.13 |
| IUPAC Name | N-[(4-propan-2-ylphenyl)methyl]ethanamine;hydrochloride |
| SMILES | CCNCc1ccc(C(C)C)cc1.Cl |
| InChI | InChI=1S/C12H19N.ClH/c1-4-13-9-11-5-7-12(8-6-11)10(2)3;/h5-8,10,13H,4,9H2,1-3H3;1H |
| InChIKey | VKMXWPNTYVWJHD-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.75 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |