C17H28ClN — CID 17331879
N-[(4-propan-2-ylphenyl)methyl]cycloheptanamine;hydrochloride (PubChem CID 17331879) has the molecular formula C17H28ClN and a molecular weight of 281.87 g/mol. Its IUPAC name is N-[(4-propan-2-ylphenyl)methyl]cycloheptanamine;hydrochloride.
| Compound Name | N-[(4-propan-2-ylphenyl)methyl]cycloheptanamine;hydrochloride |
|---|---|
| PubChem CID | 17331879 |
| Molecular Formula | C17H28ClN |
| Molecular Weight | 281.87 g/mol |
| Exact Mass | 281.19 |
| IUPAC Name | N-[(4-propan-2-ylphenyl)methyl]cycloheptanamine;hydrochloride |
| SMILES | CC(C)c1ccc(CNC2CCCCCC2)cc1.Cl |
| InChI | InChI=1S/C17H27N.ClH/c1-14(2)16-11-9-15(10-12-16)13-18-17-7-5-3-4-6-8-17;/h9-12,14,17-18H,3-8,13H2,1-2H3;1H |
| InChIKey | ORHLHHWLKWSDNK-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.87 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |