About azane;1-ethenyl-6-hydroxy-5-methylcyclohexa-2,4-diene-1-sulfonic acid
azane;1-ethenyl-6-hydroxy-5-methylcyclohexa-2,4-diene-1-sulfonic acid (PubChem CID 173319105) has the molecular formula C9H15NO4S
and a molecular weight of 233.29 g/mol. Its IUPAC name is azane;1-ethenyl-6-hydroxy-5-methylcyclohexa-2,4-diene-1-sulfonic acid.
Molecular Properties
| Compound Name | azane;1-ethenyl-6-hydroxy-5-methylcyclohexa-2,4-diene-1-sulfonic acid |
| PubChem CID | 173319105 |
| Molecular Formula | C9H15NO4S |
| Molecular Weight | 233.29 g/mol |
| Exact Mass | 233.07 |
| IUPAC Name | azane;1-ethenyl-6-hydroxy-5-methylcyclohexa-2,4-diene-1-sulfonic acid |
| SMILES | C=CC1(S(=O)(=O)O)C=CC=C(C)C1O.N |
| InChI | InChI=1S/C9H12O4S.H3N/c1-3-9(14(11,12)13)6-4-5-7(2)8(9)10;/h3-6,8,10H,1H2,2H3,(H,11,12,13);1H3 |
| InChIKey | AISBLVJGYWNYJQ-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 109.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.29 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze azane;1-ethenyl-6-hydroxy-5-methylcyclohexa-2,4-diene-1-sulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;1-ethenyl-6-hydroxy-5-methylcyclohexa-2,4-diene-1-sulfonic acid?
The IUPAC name of azane;1-ethenyl-6-hydroxy-5-methylcyclohexa-2,4-diene-1-sulfonic acid (CID 173319105) is azane;1-ethenyl-6-hydroxy-5-methylcyclohexa-2,4-diene-1-sulfonic acid.
What is the SMILES notation for azane;1-ethenyl-6-hydroxy-5-methylcyclohexa-2,4-diene-1-sulfonic acid?
The canonical SMILES for azane;1-ethenyl-6-hydroxy-5-methylcyclohexa-2,4-diene-1-sulfonic acid is C=CC1(S(=O)(=O)O)C=CC=C(C)C1O.N.
What is the InChIKey of azane;1-ethenyl-6-hydroxy-5-methylcyclohexa-2,4-diene-1-sulfonic acid?
The InChIKey is AISBLVJGYWNYJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O4S.H3N/c1-3-9(14(11,12)13)6-4-5-7(2)8(9)10;/h3-6,8,10H,1H2,2H3,(H,11,12,13);1H3.
What are the key properties of azane;1-ethenyl-6-hydroxy-5-methylcyclohexa-2,4-diene-1-sulfonic acid?
azane;1-ethenyl-6-hydroxy-5-methylcyclohexa-2,4-diene-1-sulfonic acid has a molecular weight of 233.29 g/mol, XLogP of 0.84, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azane;1-ethenyl-6-hydroxy-5-methylcyclohexa-2,4-diene-1-sulfonic acid is sourced from PubChem (CID 173319105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).