About 1-deuterio-4H-quinoline
1-deuterio-4H-quinoline (PubChem CID 173319795) has the molecular formula C9H9N
and a molecular weight of 132.18 g/mol. Its IUPAC name is 1-deuterio-4H-quinoline.
Molecular Properties
| Compound Name | 1-deuterio-4H-quinoline |
| PubChem CID | 173319795 |
| Molecular Formula | C9H9N |
| Molecular Weight | 132.18 g/mol |
| Exact Mass | 132.08 |
| IUPAC Name | 1-deuterio-4H-quinoline |
| SMILES | [2H]N1C=CCc2ccccc21 |
| InChI | InChI=1S/C9H9N/c1-2-6-9-8(4-1)5-3-7-10-9/h1-4,6-7,10H,5H2/i/hD |
| InChIKey | ROBKVGDBQLURAF-DYCDLGHISA-N |
| XLogP | 2.17 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.18 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-deuterio-4H-quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-deuterio-4H-quinoline?
The IUPAC name of 1-deuterio-4H-quinoline (CID 173319795) is 1-deuterio-4H-quinoline.
What is the SMILES notation for 1-deuterio-4H-quinoline?
The canonical SMILES for 1-deuterio-4H-quinoline is [2H]N1C=CCc2ccccc21.
What is the InChIKey of 1-deuterio-4H-quinoline?
The InChIKey is ROBKVGDBQLURAF-DYCDLGHISA-N. The full InChI is InChI=1S/C9H9N/c1-2-6-9-8(4-1)5-3-7-10-9/h1-4,6-7,10H,5H2/i/hD.
What are the key properties of 1-deuterio-4H-quinoline?
1-deuterio-4H-quinoline has a molecular weight of 132.18 g/mol, XLogP of 2.17, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-deuterio-4H-quinoline is sourced from PubChem (CID 173319795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).