About 4-[4-[4-[(Z)-1,2-dichloroethenyl]phenyl]phenyl]-1-propylsilinane
4-[4-[4-[(Z)-1,2-dichloroethenyl]phenyl]phenyl]-1-propylsilinane (PubChem CID 173320857) has the molecular formula C22H26Cl2Si
and a molecular weight of 389.44 g/mol. Its IUPAC name is 4-[4-[4-[(Z)-1,2-dichloroethenyl]phenyl]phenyl]-1-propylsilinane.
Molecular Properties
| Compound Name | 4-[4-[4-[(Z)-1,2-dichloroethenyl]phenyl]phenyl]-1-propylsilinane |
| PubChem CID | 173320857 |
| Molecular Formula | C22H26Cl2Si |
| Molecular Weight | 389.44 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | 4-[4-[4-[(Z)-1,2-dichloroethenyl]phenyl]phenyl]-1-propylsilinane |
| SMILES | CCC[SiH]1CCC(c2ccc(-c3ccc(/C(Cl)=C/Cl)cc3)cc2)CC1 |
| InChI | InChI=1S/C22H26Cl2Si/c1-2-13-25-14-11-20(12-15-25)19-5-3-17(4-6-19)18-7-9-21(10-8-18)22(24)16-23/h3-10,16,20,25H,2,11-15H2,1H3/b22-16- |
| InChIKey | QKIIBAVWADWADG-JWGURIENSA-N |
| XLogP | 7.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 389.44 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 4-[4-[4-[(Z)-1,2-dichloroethenyl]phenyl]phenyl]-1-propylsilinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-[4-[(Z)-1,2-dichloroethenyl]phenyl]phenyl]-1-propylsilinane?
The IUPAC name of 4-[4-[4-[(Z)-1,2-dichloroethenyl]phenyl]phenyl]-1-propylsilinane (CID 173320857) is 4-[4-[4-[(Z)-1,2-dichloroethenyl]phenyl]phenyl]-1-propylsilinane.
What is the SMILES notation for 4-[4-[4-[(Z)-1,2-dichloroethenyl]phenyl]phenyl]-1-propylsilinane?
The canonical SMILES for 4-[4-[4-[(Z)-1,2-dichloroethenyl]phenyl]phenyl]-1-propylsilinane is CCC[SiH]1CCC(c2ccc(-c3ccc(/C(Cl)=C/Cl)cc3)cc2)CC1.
What is the InChIKey of 4-[4-[4-[(Z)-1,2-dichloroethenyl]phenyl]phenyl]-1-propylsilinane?
The InChIKey is QKIIBAVWADWADG-JWGURIENSA-N. The full InChI is InChI=1S/C22H26Cl2Si/c1-2-13-25-14-11-20(12-15-25)19-5-3-17(4-6-19)18-7-9-21(10-8-18)22(24)16-23/h3-10,16,20,25H,2,11-15H2,1H3/b22-16-.
What are the key properties of 4-[4-[4-[(Z)-1,2-dichloroethenyl]phenyl]phenyl]-1-propylsilinane?
4-[4-[4-[(Z)-1,2-dichloroethenyl]phenyl]phenyl]-1-propylsilinane has a molecular weight of 389.44 g/mol, XLogP of 7.64, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-[4-[(Z)-1,2-dichloroethenyl]phenyl]phenyl]-1-propylsilinane is sourced from PubChem (CID 173320857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).