About 1-(1-hydroxy-2,5-dioxopyrrolidin-1-ium-3-yl)pyrrole-2,5-dione
1-(1-hydroxy-2,5-dioxopyrrolidin-1-ium-3-yl)pyrrole-2,5-dione (PubChem CID 173321852) has the molecular formula C8H7N2O5+
and a molecular weight of 211.15 g/mol. Its IUPAC name is 1-(1-hydroxy-2,5-dioxopyrrolidin-1-ium-3-yl)pyrrole-2,5-dione.
Molecular Properties
| Compound Name | 1-(1-hydroxy-2,5-dioxopyrrolidin-1-ium-3-yl)pyrrole-2,5-dione |
| PubChem CID | 173321852 |
| Molecular Formula | C8H7N2O5+ |
| Molecular Weight | 211.15 g/mol |
| Exact Mass | 211.03 |
| IUPAC Name | 1-(1-hydroxy-2,5-dioxopyrrolidin-1-ium-3-yl)pyrrole-2,5-dione |
| SMILES | O=C1C=CC(=O)N1C1CC(=O)[NH+](O)C1=O |
| InChI | InChI=1S/C8H6N2O5/c11-5-1-2-6(12)9(5)4-3-7(13)10(15)8(4)14/h1-2,4,15H,3H2/p+1 |
| InChIKey | IXCOVHIIBFIPCK-UHFFFAOYSA-O |
| XLogP | -2.99 |
| TPSA | 96.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.15 |
| LogP ≤ 5 | -2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 1-(1-hydroxy-2,5-dioxopyrrolidin-1-ium-3-yl)pyrrole-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-hydroxy-2,5-dioxopyrrolidin-1-ium-3-yl)pyrrole-2,5-dione?
The IUPAC name of 1-(1-hydroxy-2,5-dioxopyrrolidin-1-ium-3-yl)pyrrole-2,5-dione (CID 173321852) is 1-(1-hydroxy-2,5-dioxopyrrolidin-1-ium-3-yl)pyrrole-2,5-dione.
What is the SMILES notation for 1-(1-hydroxy-2,5-dioxopyrrolidin-1-ium-3-yl)pyrrole-2,5-dione?
The canonical SMILES for 1-(1-hydroxy-2,5-dioxopyrrolidin-1-ium-3-yl)pyrrole-2,5-dione is O=C1C=CC(=O)N1C1CC(=O)[NH+](O)C1=O.
What is the InChIKey of 1-(1-hydroxy-2,5-dioxopyrrolidin-1-ium-3-yl)pyrrole-2,5-dione?
The InChIKey is IXCOVHIIBFIPCK-UHFFFAOYSA-O. The full InChI is InChI=1S/C8H6N2O5/c11-5-1-2-6(12)9(5)4-3-7(13)10(15)8(4)14/h1-2,4,15H,3H2/p+1.
What are the key properties of 1-(1-hydroxy-2,5-dioxopyrrolidin-1-ium-3-yl)pyrrole-2,5-dione?
1-(1-hydroxy-2,5-dioxopyrrolidin-1-ium-3-yl)pyrrole-2,5-dione has a molecular weight of 211.15 g/mol, XLogP of -2.99, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-hydroxy-2,5-dioxopyrrolidin-1-ium-3-yl)pyrrole-2,5-dione is sourced from PubChem (CID 173321852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).