About 1,4-didecyl-2-methylimidazole;hydrobromide
1,4-didecyl-2-methylimidazole;hydrobromide (PubChem CID 173322060) has the molecular formula C24H47BrN2
and a molecular weight of 443.56 g/mol. Its IUPAC name is 1,4-didecyl-2-methylimidazole;hydrobromide.
Molecular Properties
| Compound Name | 1,4-didecyl-2-methylimidazole;hydrobromide |
| PubChem CID | 173322060 |
| Molecular Formula | C24H47BrN2 |
| Molecular Weight | 443.56 g/mol |
| Exact Mass | 442.29 |
| IUPAC Name | 1,4-didecyl-2-methylimidazole;hydrobromide |
| SMILES | Br.CCCCCCCCCCc1cn(CCCCCCCCCC)c(C)n1 |
| InChI | InChI=1S/C24H46N2.BrH/c1-4-6-8-10-12-14-16-18-20-24-22-26(23(3)25-24)21-19-17-15-13-11-9-7-5-2;/h22H,4-21H2,1-3H3;1H |
| InChIKey | BHBPQDKRZTYFLV-UHFFFAOYSA-N |
| XLogP | 8.59 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 443.56 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1,4-didecyl-2-methylimidazole;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-didecyl-2-methylimidazole;hydrobromide?
The IUPAC name of 1,4-didecyl-2-methylimidazole;hydrobromide (CID 173322060) is 1,4-didecyl-2-methylimidazole;hydrobromide.
What is the SMILES notation for 1,4-didecyl-2-methylimidazole;hydrobromide?
The canonical SMILES for 1,4-didecyl-2-methylimidazole;hydrobromide is Br.CCCCCCCCCCc1cn(CCCCCCCCCC)c(C)n1.
What is the InChIKey of 1,4-didecyl-2-methylimidazole;hydrobromide?
The InChIKey is BHBPQDKRZTYFLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H46N2.BrH/c1-4-6-8-10-12-14-16-18-20-24-22-26(23(3)25-24)21-19-17-15-13-11-9-7-5-2;/h22H,4-21H2,1-3H3;1H.
What are the key properties of 1,4-didecyl-2-methylimidazole;hydrobromide?
1,4-didecyl-2-methylimidazole;hydrobromide has a molecular weight of 443.56 g/mol, XLogP of 8.59, 18 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-didecyl-2-methylimidazole;hydrobromide is sourced from PubChem (CID 173322060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).