C21H32N2O4SSi — CID 173322574
1-[(2-dimethylsilyloxy-3,3-dimethylbutoxy)methyl]-5-ethyl-6-phenylsulfanylpyrimidine-2,4-dione (PubChem CID 173322574) has the molecular formula C21H32N2O4SSi and a molecular weight of 436.65 g/mol. Its IUPAC name is 1-[(2-dimethylsilyloxy-3,3-dimethylbutoxy)methyl]-5-ethyl-6-phenylsulfanylpyrimidine-2,4-dione.
| Compound Name | 1-[(2-dimethylsilyloxy-3,3-dimethylbutoxy)methyl]-5-ethyl-6-phenylsulfanylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 173322574 |
| Molecular Formula | C21H32N2O4SSi |
| Molecular Weight | 436.65 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | 1-[(2-dimethylsilyloxy-3,3-dimethylbutoxy)methyl]-5-ethyl-6-phenylsulfanylpyrimidine-2,4-dione |
| SMILES | CCc1c(Sc2ccccc2)n(COCC(O[SiH](C)C)C(C)(C)C)c(=O)[nH]c1=O |
| InChI | InChI=1S/C21H32N2O4SSi/c1-7-16-18(24)22-20(25)23(19(16)28-15-11-9-8-10-12-15)14-26-13-17(21(2,3)4)27-29(5)6/h8-12,17,29H,7,13-14H2,1-6H3,(H,22,24,25) |
| InChIKey | PIBWWSCEYCNRKW-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.65 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|