C14H18 — CID 173322615
6-ethenyl-2,3,3-trimethyl-1,2-dihydroindene (PubChem CID 173322615) has the molecular formula C14H18 and a molecular weight of 186.30 g/mol. Its IUPAC name is 6-ethenyl-2,3,3-trimethyl-1,2-dihydroindene.
| Compound Name | 6-ethenyl-2,3,3-trimethyl-1,2-dihydroindene |
|---|---|
| PubChem CID | 173322615 |
| Molecular Formula | C14H18 |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.14 |
| IUPAC Name | 6-ethenyl-2,3,3-trimethyl-1,2-dihydroindene |
| SMILES | C=Cc1ccc2c(c1)CC(C)C2(C)C |
| InChI | InChI=1S/C14H18/c1-5-11-6-7-13-12(9-11)8-10(2)14(13,3)4/h5-7,9-10H,1,8H2,2-4H3 |
| InChIKey | PGHBCMDFVSTFAX-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |