C23H42N4 — CID 173322817
azane;1-tert-butyl-2-methylbenzene;2,4,6-triethylbenzene-1,3-diamine (PubChem CID 173322817) has the molecular formula C23H42N4 and a molecular weight of 374.62 g/mol. Its IUPAC name is azane;1-tert-butyl-2-methylbenzene;2,4,6-triethylbenzene-1,3-diamine.
| Compound Name | azane;1-tert-butyl-2-methylbenzene;2,4,6-triethylbenzene-1,3-diamine |
|---|---|
| PubChem CID | 173322817 |
| Molecular Formula | C23H42N4 |
| Molecular Weight | 374.62 g/mol |
| Exact Mass | 374.34 |
| IUPAC Name | azane;1-tert-butyl-2-methylbenzene;2,4,6-triethylbenzene-1,3-diamine |
| SMILES | CCc1cc(CC)c(N)c(CC)c1N.Cc1ccccc1C(C)(C)C.N.N |
| InChI | InChI=1S/C12H20N2.C11H16.2H3N/c1-4-8-7-9(5-2)12(14)10(6-3)11(8)13;1-9-7-5-6-8-10(9)11(2,3)4;;/h7H,4-6,13-14H2,1-3H3;5-8H,1-4H3;2*1H3 |
| InChIKey | MAMQZTKMNIILQM-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 122.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.62 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|