About 1,2,4-trifluorobut-3-en-1-ol
1,2,4-trifluorobut-3-en-1-ol (PubChem CID 173323536) has the molecular formula C4H5F3O
and a molecular weight of 126.08 g/mol. Its IUPAC name is 1,2,4-trifluorobut-3-en-1-ol.
Molecular Properties
| Compound Name | 1,2,4-trifluorobut-3-en-1-ol |
| PubChem CID | 173323536 |
| Molecular Formula | C4H5F3O |
| Molecular Weight | 126.08 g/mol |
| Exact Mass | 126.03 |
| IUPAC Name | 1,2,4-trifluorobut-3-en-1-ol |
| SMILES | OC(F)C(F)C=CF |
| InChI | InChI=1S/C4H5F3O/c5-2-1-3(6)4(7)8/h1-4,8H |
| InChIKey | NWBHKMWEGZEYKR-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.08 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,2,4-trifluorobut-3-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2,4-trifluorobut-3-en-1-ol?
The IUPAC name of 1,2,4-trifluorobut-3-en-1-ol (CID 173323536) is 1,2,4-trifluorobut-3-en-1-ol.
What is the SMILES notation for 1,2,4-trifluorobut-3-en-1-ol?
The canonical SMILES for 1,2,4-trifluorobut-3-en-1-ol is OC(F)C(F)C=CF.
What is the InChIKey of 1,2,4-trifluorobut-3-en-1-ol?
The InChIKey is NWBHKMWEGZEYKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5F3O/c5-2-1-3(6)4(7)8/h1-4,8H.
What are the key properties of 1,2,4-trifluorobut-3-en-1-ol?
1,2,4-trifluorobut-3-en-1-ol has a molecular weight of 126.08 g/mol, XLogP of 1.10, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2,4-trifluorobut-3-en-1-ol is sourced from PubChem (CID 173323536), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).