C22H21Cl8N5O3S — CID 173323816
4-[2-[4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]buta-1,3-dienyl]-5,6-dichloro-3-ethyl-2H-benzimidazol-1-yl]butane-1-sulfonic acid (PubChem CID 173323816) has the molecular formula C22H21Cl8N5O3S and a molecular weight of 719.13 g/mol. Its IUPAC name is 4-[2-[4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]buta-1,3-dienyl]-5,6-dichloro-3-ethyl-2H-benzimidazol-1-yl]butane-1-sulfonic acid.
| Compound Name | 4-[2-[4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]buta-1,3-dienyl]-5,6-dichloro-3-ethyl-2H-benzimidazol-1-yl]butane-1-sulfonic acid |
|---|---|
| PubChem CID | 173323816 |
| Molecular Formula | C22H21Cl8N5O3S |
| Molecular Weight | 719.13 g/mol |
| Exact Mass | 714.89 |
| IUPAC Name | 4-[2-[4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]buta-1,3-dienyl]-5,6-dichloro-3-ethyl-2H-benzimidazol-1-yl]butane-1-sulfonic acid |
| SMILES | CCN1c2cc(Cl)c(Cl)cc2N(CCCCS(=O)(=O)O)C1C=CC=Cc1nc(C(Cl)(Cl)Cl)nc(C(Cl)(Cl)Cl)n1 |
| InChI | InChI=1S/C22H21Cl8N5O3S/c1-2-34-15-11-13(23)14(24)12-16(15)35(9-5-6-10-39(36,37)38)18(34)8-4-3-7-17-31-19(21(25,26)27)33-20(32-17)22(28,29)30/h3-4,7-8,11-12,18H,2,5-6,9-10H2,1H3,(H,36,37,38) |
| InChIKey | CTBZHCZZEWONAV-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.13 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|