C30H52O4Si — CID 173324085
[(1S,7S,8S,8aR)-8-[2-[(2R,4R)-4-tert-butyl-6-dimethylsilyloxyoxan-2-yl]ethyl]-7-methyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] (2S)-2-methylpentanoate (PubChem CID 173324085) has the molecular formula C30H52O4Si and a molecular weight of 504.83 g/mol. Its IUPAC name is [(1S,7S,8S,8aR)-8-[2-[(2R,4R)-4-tert-butyl-6-dimethylsilyloxyoxan-2-yl]ethyl]-7-methyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] (2S)-2-methylpentanoate.
| Compound Name | [(1S,7S,8S,8aR)-8-[2-[(2R,4R)-4-tert-butyl-6-dimethylsilyloxyoxan-2-yl]ethyl]-7-methyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] (2S)-2-methylpentanoate |
|---|---|
| PubChem CID | 173324085 |
| Molecular Formula | C30H52O4Si |
| Molecular Weight | 504.83 g/mol |
| Exact Mass | 504.36 |
| IUPAC Name | [(1S,7S,8S,8aR)-8-[2-[(2R,4R)-4-tert-butyl-6-dimethylsilyloxyoxan-2-yl]ethyl]-7-methyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] (2S)-2-methylpentanoate |
| SMILES | CCC[C@H](C)C(=O)O[C@H]1CCC=C2C=C[C@H](C)[C@H](CC[C@@H]3C[C@@H](C(C)(C)C)CC(O[SiH](C)C)O3)[C@H]21 |
| InChI | InChI=1S/C30H52O4Si/c1-9-11-21(3)29(31)33-26-13-10-12-22-15-14-20(2)25(28(22)26)17-16-24-18-23(30(4,5)6)19-27(32-24)34-35(7)8/h12,14-15,20-21,23-28,35H,9-11,13,16-19H2,1-8H3/t20-,21-,23+,24+,25-,26-,27?,28-/m0/s1 |
| InChIKey | ZZPWHRURSFQINS-UCQRPAGPSA-N |
| XLogP | 7.44 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.83 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|