C14H26ClNO3Si — CID 173324463
(2R)-2-[(2S,3S)-3-[(2R)-2-dimethylsilyloxy-3,3-dimethylbutan-2-yl]-4-oxoazetidin-2-yl]propanoyl chloride (PubChem CID 173324463) has the molecular formula C14H26ClNO3Si and a molecular weight of 319.91 g/mol. Its IUPAC name is (2R)-2-[(2S,3S)-3-[(2R)-2-dimethylsilyloxy-3,3-dimethylbutan-2-yl]-4-oxoazetidin-2-yl]propanoyl chloride.
| Compound Name | (2R)-2-[(2S,3S)-3-[(2R)-2-dimethylsilyloxy-3,3-dimethylbutan-2-yl]-4-oxoazetidin-2-yl]propanoyl chloride |
|---|---|
| PubChem CID | 173324463 |
| Molecular Formula | C14H26ClNO3Si |
| Molecular Weight | 319.91 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | (2R)-2-[(2S,3S)-3-[(2R)-2-dimethylsilyloxy-3,3-dimethylbutan-2-yl]-4-oxoazetidin-2-yl]propanoyl chloride |
| SMILES | CC(C(=O)Cl)[C@H]1NC(=O)[C@@H]1[C@@](C)(O[SiH](C)C)C(C)(C)C |
| InChI | InChI=1S/C14H26ClNO3Si/c1-8(11(15)17)10-9(12(18)16-10)14(5,13(2,3)4)19-20(6)7/h8-10,20H,1-7H3,(H,16,18)/t8?,9-,10-,14-/m1/s1 |
| InChIKey | KHQNYHBHDJHOLT-KVDVHNCBSA-N |
| XLogP | 2.31 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.91 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|