C19H30 — CID 173324506
(1S,4R)-2,3-dimethylbicyclo[2.2.1]hept-2-ene;2,7,7-trimethylbicyclo[2.2.1]hept-2-ene (PubChem CID 173324506) has the molecular formula C19H30 and a molecular weight of 258.45 g/mol. Its IUPAC name is (1S,4R)-2,3-dimethylbicyclo[2.2.1]hept-2-ene;2,7,7-trimethylbicyclo[2.2.1]hept-2-ene.
| Compound Name | (1S,4R)-2,3-dimethylbicyclo[2.2.1]hept-2-ene;2,7,7-trimethylbicyclo[2.2.1]hept-2-ene |
|---|---|
| PubChem CID | 173324506 |
| Molecular Formula | C19H30 |
| Molecular Weight | 258.45 g/mol |
| Exact Mass | 258.23 |
| IUPAC Name | (1S,4R)-2,3-dimethylbicyclo[2.2.1]hept-2-ene;2,7,7-trimethylbicyclo[2.2.1]hept-2-ene |
| SMILES | CC1=C(C)[C@H]2CC[C@@H]1C2.CC1=CC2CCC1C2(C)C |
| InChI | InChI=1S/C10H16.C9H14/c1-7-6-8-4-5-9(7)10(8,2)3;1-6-7(2)9-4-3-8(6)5-9/h6,8-9H,4-5H2,1-3H3;8-9H,3-5H2,1-2H3/t;8-,9+ |
| InChIKey | PUFIRZDRFVWCAA-YGAACVALSA-N |
| XLogP | 5.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.45 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|