C17H30BrNO — CID 173324924
10-bromo-4-[2-(dimethylamino)ethyl]-3,5-dimethylundeca-2,5,9-trien-4-ol (PubChem CID 173324924) has the molecular formula C17H30BrNO and a molecular weight of 344.34 g/mol. Its IUPAC name is 10-bromo-4-[2-(dimethylamino)ethyl]-3,5-dimethylundeca-2,5,9-trien-4-ol.
| Compound Name | 10-bromo-4-[2-(dimethylamino)ethyl]-3,5-dimethylundeca-2,5,9-trien-4-ol |
|---|---|
| PubChem CID | 173324924 |
| Molecular Formula | C17H30BrNO |
| Molecular Weight | 344.34 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | 10-bromo-4-[2-(dimethylamino)ethyl]-3,5-dimethylundeca-2,5,9-trien-4-ol |
| SMILES | CC=C(C)C(O)(CCN(C)C)C(C)=CCCC=C(C)Br |
| InChI | InChI=1S/C17H30BrNO/c1-7-14(2)17(20,12-13-19(5)6)15(3)10-8-9-11-16(4)18/h7,10-11,20H,8-9,12-13H2,1-6H3 |
| InChIKey | QIYVEHQUTCKLRZ-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.34 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|