C17H32BrNO — CID 173324925
2-bromobut-2-ene;4-[1-(dimethylamino)ethyl]-3,5-dimethylhepta-2,5-dien-4-ol (PubChem CID 173324925) has the molecular formula C17H32BrNO and a molecular weight of 346.35 g/mol. Its IUPAC name is 2-bromobut-2-ene;4-[1-(dimethylamino)ethyl]-3,5-dimethylhepta-2,5-dien-4-ol.
| Compound Name | 2-bromobut-2-ene;4-[1-(dimethylamino)ethyl]-3,5-dimethylhepta-2,5-dien-4-ol |
|---|---|
| PubChem CID | 173324925 |
| Molecular Formula | C17H32BrNO |
| Molecular Weight | 346.35 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | 2-bromobut-2-ene;4-[1-(dimethylamino)ethyl]-3,5-dimethylhepta-2,5-dien-4-ol |
| SMILES | CC=C(C)Br.CC=C(C)C(O)(C(C)=CC)C(C)N(C)C |
| InChI | InChI=1S/C13H25NO.C4H7Br/c1-8-10(3)13(15,11(4)9-2)12(5)14(6)7;1-3-4(2)5/h8-9,12,15H,1-7H3;3H,1-2H3 |
| InChIKey | PCXMGDARQRQUHX-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.35 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|