About 2-bromobut-2-ene;4-[1-(dimethylamino)ethyl]-3,5-dimethylhepta-2,5-dien-4-ol
2-bromobut-2-ene;4-[1-(dimethylamino)ethyl]-3,5-dimethylhepta-2,5-dien-4-ol (PubChem CID 173324925) has the molecular formula C17H32BrNO
and a molecular weight of 346.35 g/mol. Its IUPAC name is 2-bromobut-2-ene;4-[1-(dimethylamino)ethyl]-3,5-dimethylhepta-2,5-dien-4-ol.
Molecular Properties
| Compound Name | 2-bromobut-2-ene;4-[1-(dimethylamino)ethyl]-3,5-dimethylhepta-2,5-dien-4-ol |
| PubChem CID | 173324925 |
| Molecular Formula | C17H32BrNO |
| Molecular Weight | 346.35 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | 2-bromobut-2-ene;4-[1-(dimethylamino)ethyl]-3,5-dimethylhepta-2,5-dien-4-ol |
| SMILES | CC=C(C)Br.CC=C(C)C(O)(C(C)=CC)C(C)N(C)C |
| InChI | InChI=1S/C13H25NO.C4H7Br/c1-8-10(3)13(15,11(4)9-2)12(5)14(6)7;1-3-4(2)5/h8-9,12,15H,1-7H3;3H,1-2H3 |
| InChIKey | PCXMGDARQRQUHX-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.35 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-bromobut-2-ene;4-[1-(dimethylamino)ethyl]-3,5-dimethylhepta-2,5-dien-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromobut-2-ene;4-[1-(dimethylamino)ethyl]-3,5-dimethylhepta-2,5-dien-4-ol?
The IUPAC name of 2-bromobut-2-ene;4-[1-(dimethylamino)ethyl]-3,5-dimethylhepta-2,5-dien-4-ol (CID 173324925) is 2-bromobut-2-ene;4-[1-(dimethylamino)ethyl]-3,5-dimethylhepta-2,5-dien-4-ol.
What is the SMILES notation for 2-bromobut-2-ene;4-[1-(dimethylamino)ethyl]-3,5-dimethylhepta-2,5-dien-4-ol?
The canonical SMILES for 2-bromobut-2-ene;4-[1-(dimethylamino)ethyl]-3,5-dimethylhepta-2,5-dien-4-ol is CC=C(C)Br.CC=C(C)C(O)(C(C)=CC)C(C)N(C)C.
What is the InChIKey of 2-bromobut-2-ene;4-[1-(dimethylamino)ethyl]-3,5-dimethylhepta-2,5-dien-4-ol?
The InChIKey is PCXMGDARQRQUHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25NO.C4H7Br/c1-8-10(3)13(15,11(4)9-2)12(5)14(6)7;1-3-4(2)5/h8-9,12,15H,1-7H3;3H,1-2H3.
What are the key properties of 2-bromobut-2-ene;4-[1-(dimethylamino)ethyl]-3,5-dimethylhepta-2,5-dien-4-ol?
2-bromobut-2-ene;4-[1-(dimethylamino)ethyl]-3,5-dimethylhepta-2,5-dien-4-ol has a molecular weight of 346.35 g/mol, XLogP of 4.91, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromobut-2-ene;4-[1-(dimethylamino)ethyl]-3,5-dimethylhepta-2,5-dien-4-ol is sourced from PubChem (CID 173324925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).