About 2-cyclopenta-1,4-dien-1-ylpropyl(dimethyl)phosphane;zirconium;trihydrochloride
2-cyclopenta-1,4-dien-1-ylpropyl(dimethyl)phosphane;zirconium;trihydrochloride (PubChem CID 173325373) has the molecular formula C10H19Cl3PZr-
and a molecular weight of 367.82 g/mol. Its IUPAC name is 2-cyclopenta-1,4-dien-1-ylpropyl(dimethyl)phosphane;zirconium;trihydrochloride.
Molecular Properties
| Compound Name | 2-cyclopenta-1,4-dien-1-ylpropyl(dimethyl)phosphane;zirconium;trihydrochloride |
| PubChem CID | 173325373 |
| Molecular Formula | C10H19Cl3PZr- |
| Molecular Weight | 367.82 g/mol |
| Exact Mass | 364.93 |
| IUPAC Name | 2-cyclopenta-1,4-dien-1-ylpropyl(dimethyl)phosphane;zirconium;trihydrochloride |
| SMILES | CC(CP(C)C)C1=[C-]CC=C1.Cl.Cl.Cl.[Zr] |
| InChI | InChI=1S/C10H16P.3ClH.Zr/c1-9(8-11(2)3)10-6-4-5-7-10;;;;/h4,6,9H,5,8H2,1-3H3;3*1H;/q-1;;;; |
| InChIKey | BDFVUTYDRVFZCH-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.82 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-cyclopenta-1,4-dien-1-ylpropyl(dimethyl)phosphane;zirconium;trihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopenta-1,4-dien-1-ylpropyl(dimethyl)phosphane;zirconium;trihydrochloride?
The IUPAC name of 2-cyclopenta-1,4-dien-1-ylpropyl(dimethyl)phosphane;zirconium;trihydrochloride (CID 173325373) is 2-cyclopenta-1,4-dien-1-ylpropyl(dimethyl)phosphane;zirconium;trihydrochloride.
What is the SMILES notation for 2-cyclopenta-1,4-dien-1-ylpropyl(dimethyl)phosphane;zirconium;trihydrochloride?
The canonical SMILES for 2-cyclopenta-1,4-dien-1-ylpropyl(dimethyl)phosphane;zirconium;trihydrochloride is CC(CP(C)C)C1=[C-]CC=C1.Cl.Cl.Cl.[Zr].
What is the InChIKey of 2-cyclopenta-1,4-dien-1-ylpropyl(dimethyl)phosphane;zirconium;trihydrochloride?
The InChIKey is BDFVUTYDRVFZCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16P.3ClH.Zr/c1-9(8-11(2)3)10-6-4-5-7-10;;;;/h4,6,9H,5,8H2,1-3H3;3*1H;/q-1;;;;.
What are the key properties of 2-cyclopenta-1,4-dien-1-ylpropyl(dimethyl)phosphane;zirconium;trihydrochloride?
2-cyclopenta-1,4-dien-1-ylpropyl(dimethyl)phosphane;zirconium;trihydrochloride has a molecular weight of 367.82 g/mol, XLogP of 4.32, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopenta-1,4-dien-1-ylpropyl(dimethyl)phosphane;zirconium;trihydrochloride is sourced from PubChem (CID 173325373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).