About 2-amino-1-(2,6-ditert-butyl-4-hydroperoxyphenyl)ethanol
2-amino-1-(2,6-ditert-butyl-4-hydroperoxyphenyl)ethanol (PubChem CID 173325621) has the molecular formula C16H27NO3
and a molecular weight of 281.40 g/mol. Its IUPAC name is 2-amino-1-(2,6-ditert-butyl-4-hydroperoxyphenyl)ethanol.
Molecular Properties
| Compound Name | 2-amino-1-(2,6-ditert-butyl-4-hydroperoxyphenyl)ethanol |
| PubChem CID | 173325621 |
| Molecular Formula | C16H27NO3 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.20 |
| IUPAC Name | 2-amino-1-(2,6-ditert-butyl-4-hydroperoxyphenyl)ethanol |
| SMILES | CC(C)(C)c1cc(OO)cc(C(C)(C)C)c1C(O)CN |
| InChI | InChI=1S/C16H27NO3/c1-15(2,3)11-7-10(20-19)8-12(16(4,5)6)14(11)13(18)9-17/h7-8,13,18-19H,9,17H2,1-6H3 |
| InChIKey | FDZVOTABKRQRBY-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-1-(2,6-ditert-butyl-4-hydroperoxyphenyl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-1-(2,6-ditert-butyl-4-hydroperoxyphenyl)ethanol?
The IUPAC name of 2-amino-1-(2,6-ditert-butyl-4-hydroperoxyphenyl)ethanol (CID 173325621) is 2-amino-1-(2,6-ditert-butyl-4-hydroperoxyphenyl)ethanol.
What is the SMILES notation for 2-amino-1-(2,6-ditert-butyl-4-hydroperoxyphenyl)ethanol?
The canonical SMILES for 2-amino-1-(2,6-ditert-butyl-4-hydroperoxyphenyl)ethanol is CC(C)(C)c1cc(OO)cc(C(C)(C)C)c1C(O)CN.
What is the InChIKey of 2-amino-1-(2,6-ditert-butyl-4-hydroperoxyphenyl)ethanol?
The InChIKey is FDZVOTABKRQRBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H27NO3/c1-15(2,3)11-7-10(20-19)8-12(16(4,5)6)14(11)13(18)9-17/h7-8,13,18-19H,9,17H2,1-6H3.
What are the key properties of 2-amino-1-(2,6-ditert-butyl-4-hydroperoxyphenyl)ethanol?
2-amino-1-(2,6-ditert-butyl-4-hydroperoxyphenyl)ethanol has a molecular weight of 281.40 g/mol, XLogP of 3.13, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-1-(2,6-ditert-butyl-4-hydroperoxyphenyl)ethanol is sourced from PubChem (CID 173325621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).