About bromo(dichloro)methane;chlorosilane
bromo(dichloro)methane;chlorosilane (PubChem CID 173326151) has the molecular formula CH4BrCl3Si
and a molecular weight of 230.39 g/mol. Its IUPAC name is bromo(dichloro)methane;chlorosilane.
Molecular Properties
| Compound Name | bromo(dichloro)methane;chlorosilane |
| PubChem CID | 173326151 |
| Molecular Formula | CH4BrCl3Si |
| Molecular Weight | 230.39 g/mol |
| Exact Mass | 227.83 |
| IUPAC Name | bromo(dichloro)methane;chlorosilane |
| SMILES | ClC(Cl)Br.[SiH3]Cl |
| InChI | InChI=1S/CHBrCl2.ClH3Si/c2-1(3)4;1-2/h1H;2H3 |
| InChIKey | RVIYADGFBDBSQK-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.39 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze bromo(dichloro)methane;chlorosilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bromo(dichloro)methane;chlorosilane?
The IUPAC name of bromo(dichloro)methane;chlorosilane (CID 173326151) is bromo(dichloro)methane;chlorosilane.
What is the SMILES notation for bromo(dichloro)methane;chlorosilane?
The canonical SMILES for bromo(dichloro)methane;chlorosilane is ClC(Cl)Br.[SiH3]Cl.
What is the InChIKey of bromo(dichloro)methane;chlorosilane?
The InChIKey is RVIYADGFBDBSQK-UHFFFAOYSA-N. The full InChI is InChI=1S/CHBrCl2.ClH3Si/c2-1(3)4;1-2/h1H;2H3.
What are the key properties of bromo(dichloro)methane;chlorosilane?
bromo(dichloro)methane;chlorosilane has a molecular weight of 230.39 g/mol, XLogP of 1.65, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bromo(dichloro)methane;chlorosilane is sourced from PubChem (CID 173326151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).