About ethylidenethiourea;thiourea
ethylidenethiourea;thiourea (PubChem CID 173326399) has the molecular formula C4H10N4S2
and a molecular weight of 178.29 g/mol. Its IUPAC name is ethylidenethiourea;thiourea.
Molecular Properties
| Compound Name | ethylidenethiourea;thiourea |
| PubChem CID | 173326399 |
| Molecular Formula | C4H10N4S2 |
| Molecular Weight | 178.29 g/mol |
| Exact Mass | 178.03 |
| IUPAC Name | ethylidenethiourea;thiourea |
| SMILES | CC=NC(N)=S.NC(N)=S |
| InChI | InChI=1S/C3H6N2S.CH4N2S/c1-2-5-3(4)6;2-1(3)4/h2H,1H3,(H2,4,6);(H4,2,3,4) |
| InChIKey | YFMGAMLWYISZIR-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 90.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.29 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze ethylidenethiourea;thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethylidenethiourea;thiourea?
The IUPAC name of ethylidenethiourea;thiourea (CID 173326399) is ethylidenethiourea;thiourea.
What is the SMILES notation for ethylidenethiourea;thiourea?
The canonical SMILES for ethylidenethiourea;thiourea is CC=NC(N)=S.NC(N)=S.
What is the InChIKey of ethylidenethiourea;thiourea?
The InChIKey is YFMGAMLWYISZIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6N2S.CH4N2S/c1-2-5-3(4)6;2-1(3)4/h2H,1H3,(H2,4,6);(H4,2,3,4).
What are the key properties of ethylidenethiourea;thiourea?
ethylidenethiourea;thiourea has a molecular weight of 178.29 g/mol, XLogP of -0.49, 0 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethylidenethiourea;thiourea is sourced from PubChem (CID 173326399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).