About 1-(1-cyclopenta-1,3-dien-1-ylethyl)cyclopenta-1,3-diene;ethanolate;titanium(4+)
1-(1-cyclopenta-1,3-dien-1-ylethyl)cyclopenta-1,3-diene;ethanolate;titanium(4+) (PubChem CID 173327011) has the molecular formula C18H28O3Ti
and a molecular weight of 340.29 g/mol. Its IUPAC name is 1-(1-cyclopenta-1,3-dien-1-ylethyl)cyclopenta-1,3-diene;ethanolate;titanium(4+).
Molecular Properties
| Compound Name | 1-(1-cyclopenta-1,3-dien-1-ylethyl)cyclopenta-1,3-diene;ethanolate;titanium(4+) |
| PubChem CID | 173327011 |
| Molecular Formula | C18H28O3Ti |
| Molecular Weight | 340.29 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | 1-(1-cyclopenta-1,3-dien-1-ylethyl)cyclopenta-1,3-diene;ethanolate;titanium(4+) |
| SMILES | CC[O-].CC[O-].CC[O-].[CH2-]C(C1=CC=CC1)C1=CC=CC1.[Ti+4] |
| InChI | InChI=1S/C12H13.3C2H5O.Ti/c1-10(11-6-2-3-7-11)12-8-4-5-9-12;3*1-2-3;/h2-6,8,10H,1,7,9H2;3*2H2,1H3;/q4*-1;+4 |
| InChIKey | RTAWDPTVACKTRW-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 69.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.29 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 1-(1-cyclopenta-1,3-dien-1-ylethyl)cyclopenta-1,3-diene;ethanolate;titanium(4+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-cyclopenta-1,3-dien-1-ylethyl)cyclopenta-1,3-diene;ethanolate;titanium(4+)?
The IUPAC name of 1-(1-cyclopenta-1,3-dien-1-ylethyl)cyclopenta-1,3-diene;ethanolate;titanium(4+) (CID 173327011) is 1-(1-cyclopenta-1,3-dien-1-ylethyl)cyclopenta-1,3-diene;ethanolate;titanium(4+).
What is the SMILES notation for 1-(1-cyclopenta-1,3-dien-1-ylethyl)cyclopenta-1,3-diene;ethanolate;titanium(4+)?
The canonical SMILES for 1-(1-cyclopenta-1,3-dien-1-ylethyl)cyclopenta-1,3-diene;ethanolate;titanium(4+) is CC[O-].CC[O-].CC[O-].[CH2-]C(C1=CC=CC1)C1=CC=CC1.[Ti+4].
What is the InChIKey of 1-(1-cyclopenta-1,3-dien-1-ylethyl)cyclopenta-1,3-diene;ethanolate;titanium(4+)?
The InChIKey is RTAWDPTVACKTRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13.3C2H5O.Ti/c1-10(11-6-2-3-7-11)12-8-4-5-9-12;3*1-2-3;/h2-6,8,10H,1,7,9H2;3*2H2,1H3;/q4*-1;+4.
What are the key properties of 1-(1-cyclopenta-1,3-dien-1-ylethyl)cyclopenta-1,3-diene;ethanolate;titanium(4+)?
1-(1-cyclopenta-1,3-dien-1-ylethyl)cyclopenta-1,3-diene;ethanolate;titanium(4+) has a molecular weight of 340.29 g/mol, XLogP of 1.31, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-cyclopenta-1,3-dien-1-ylethyl)cyclopenta-1,3-diene;ethanolate;titanium(4+) is sourced from PubChem (CID 173327011), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).