C19H32F8O6Si3 — CID 173327176
2-(2,4-dimethyl-4-trimethylsilyloxysilyloxysilylpentan-2-yl)-3-(2,2,3,3,4,4,5,5-octafluoropentyl)but-2-enedioic acid (PubChem CID 173327176) has the molecular formula C19H32F8O6Si3 and a molecular weight of 592.70 g/mol. Its IUPAC name is 2-(2,4-dimethyl-4-trimethylsilyloxysilyloxysilylpentan-2-yl)-3-(2,2,3,3,4,4,5,5-octafluoropentyl)but-2-enedioic acid.
| Compound Name | 2-(2,4-dimethyl-4-trimethylsilyloxysilyloxysilylpentan-2-yl)-3-(2,2,3,3,4,4,5,5-octafluoropentyl)but-2-enedioic acid |
|---|---|
| PubChem CID | 173327176 |
| Molecular Formula | C19H32F8O6Si3 |
| Molecular Weight | 592.70 g/mol |
| Exact Mass | 592.14 |
| IUPAC Name | 2-(2,4-dimethyl-4-trimethylsilyloxysilyloxysilylpentan-2-yl)-3-(2,2,3,3,4,4,5,5-octafluoropentyl)but-2-enedioic acid |
| SMILES | CC(C)(CC(C)(C)C(C(=O)O)=C(CC(F)(F)C(F)(F)C(F)(F)C(F)F)C(=O)O)[SiH2]O[SiH2]O[Si](C)(C)C |
| InChI | InChI=1S/C19H32F8O6Si3/c1-15(2,9-16(3,4)34-32-35-33-36(5,6)7)11(13(30)31)10(12(28)29)8-17(22,23)19(26,27)18(24,25)14(20)21/h14H,8-9,34-35H2,1-7H3,(H,28,29)(H,30,31) |
| InChIKey | JHKXIOAEXMSDGW-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.70 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|