C31H49NO4Si — CID 173327182
(3R,4R,5S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-nonylpiperidine-3,4,5-triol (PubChem CID 173327182) has the molecular formula C31H49NO4Si and a molecular weight of 527.82 g/mol. Its IUPAC name is (3R,4R,5S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-nonylpiperidine-3,4,5-triol.
| Compound Name | (3R,4R,5S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-nonylpiperidine-3,4,5-triol |
|---|---|
| PubChem CID | 173327182 |
| Molecular Formula | C31H49NO4Si |
| Molecular Weight | 527.82 g/mol |
| Exact Mass | 527.34 |
| IUPAC Name | (3R,4R,5S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-nonylpiperidine-3,4,5-triol |
| SMILES | CCCCCCCCCN1C[C@H](O)[C@@H](O)[C@H](O)C1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C31H49NO4Si/c1-5-6-7-8-9-10-17-22-32-23-28(33)30(35)29(34)27(32)24-36-37(31(2,3)4,25-18-13-11-14-19-25)26-20-15-12-16-21-26/h11-16,18-21,27-30,33-35H,5-10,17,22-24H2,1-4H3/t27?,28-,29+,30+/m0/s1 |
| InChIKey | DYCPFAGWDCVEOH-NIXPGEGASA-N |
| XLogP | 4.08 |
| TPSA | 73.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.82 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|