C28H43NO4Si — CID 173327186
(3R,4R,5S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-hexylpiperidine-3,4,5-triol (PubChem CID 173327186) has the molecular formula C28H43NO4Si and a molecular weight of 485.74 g/mol. Its IUPAC name is (3R,4R,5S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-hexylpiperidine-3,4,5-triol.
| Compound Name | (3R,4R,5S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-hexylpiperidine-3,4,5-triol |
|---|---|
| PubChem CID | 173327186 |
| Molecular Formula | C28H43NO4Si |
| Molecular Weight | 485.74 g/mol |
| Exact Mass | 485.30 |
| IUPAC Name | (3R,4R,5S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-hexylpiperidine-3,4,5-triol |
| SMILES | CCCCCCN1C[C@H](O)[C@@H](O)[C@H](O)C1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C28H43NO4Si/c1-5-6-7-14-19-29-20-25(30)27(32)26(31)24(29)21-33-34(28(2,3)4,22-15-10-8-11-16-22)23-17-12-9-13-18-23/h8-13,15-18,24-27,30-32H,5-7,14,19-21H2,1-4H3/t24?,25-,26+,27+/m0/s1 |
| InChIKey | FSUBSOOURDVIQC-ZHOVUOCFSA-N |
| XLogP | 2.91 |
| TPSA | 73.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.74 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|