C21H27NO5P+ — CID 173327424
benzyl carbamate;(1-ethoxy-2-methyl-1-oxo-4-phenylbutan-2-yl)-oxophosphanium (PubChem CID 173327424) has the molecular formula C21H27NO5P+ and a molecular weight of 404.42 g/mol. Its IUPAC name is benzyl carbamate;(1-ethoxy-2-methyl-1-oxo-4-phenylbutan-2-yl)-oxophosphanium.
| Compound Name | benzyl carbamate;(1-ethoxy-2-methyl-1-oxo-4-phenylbutan-2-yl)-oxophosphanium |
|---|---|
| PubChem CID | 173327424 |
| Molecular Formula | C21H27NO5P+ |
| Molecular Weight | 404.42 g/mol |
| Exact Mass | 404.16 |
| IUPAC Name | benzyl carbamate;(1-ethoxy-2-methyl-1-oxo-4-phenylbutan-2-yl)-oxophosphanium |
| SMILES | CCOC(=O)C(C)(CCc1ccccc1)[PH+]=O.NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C13H17O3P.C8H9NO2/c1-3-16-12(14)13(2,17-15)10-9-11-7-5-4-6-8-11;9-8(10)11-6-7-4-2-1-3-5-7/h4-8H,3,9-10H2,1-2H3;1-5H,6H2,(H2,9,10)/p+1 |
| InChIKey | RPZYFFKNXHHBFO-UHFFFAOYSA-O |
| XLogP | 4.25 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.42 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|