C14H24NaO4P — CID 173327470
sodium;hydride;(2-octylphenyl) dihydrogen phosphate (PubChem CID 173327470) has the molecular formula C14H24NaO4P and a molecular weight of 310.31 g/mol. Its IUPAC name is sodium;hydride;(2-octylphenyl) dihydrogen phosphate.
| Compound Name | sodium;hydride;(2-octylphenyl) dihydrogen phosphate |
|---|---|
| PubChem CID | 173327470 |
| Molecular Formula | C14H24NaO4P |
| Molecular Weight | 310.31 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | sodium;hydride;(2-octylphenyl) dihydrogen phosphate |
| SMILES | CCCCCCCCc1ccccc1OP(=O)(O)O.[H-].[Na+] |
| InChI | InChI=1S/C14H23O4P.Na.H/c1-2-3-4-5-6-7-10-13-11-8-9-12-14(13)18-19(15,16)17;;/h8-9,11-12H,2-7,10H2,1H3,(H2,15,16,17);;/q;+1;-1 |
| InChIKey | VRFNFNSRDOFEAR-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.31 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|