About bis(1-(benzo[b][1]benzoxepin-5-ylmethyl)-3,6-dihydro-2H-pyridine);but-2-enedioic acid
bis(1-(benzo[b][1]benzoxepin-5-ylmethyl)-3,6-dihydro-2H-pyridine);but-2-enedioic acid (PubChem CID 173328589) has the molecular formula C44H42N2O6
and a molecular weight of 694.83 g/mol. Its IUPAC name is bis(1-(benzo[b][1]benzoxepin-5-ylmethyl)-3,6-dihydro-2H-pyridine);but-2-enedioic acid.
Molecular Properties
| Compound Name | bis(1-(benzo[b][1]benzoxepin-5-ylmethyl)-3,6-dihydro-2H-pyridine);but-2-enedioic acid |
| PubChem CID | 173328589 |
| Molecular Formula | C44H42N2O6 |
| Molecular Weight | 694.83 g/mol |
| Exact Mass | 694.30 |
| IUPAC Name | bis(1-(benzo[b][1]benzoxepin-5-ylmethyl)-3,6-dihydro-2H-pyridine);but-2-enedioic acid |
| SMILES | C1=CCN(CC2=Cc3ccccc3Oc3ccccc32)CC1.C1=CCN(CC2=Cc3ccccc3Oc3ccccc32)CC1.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/2C20H19NO.C4H4O4/c2*1-6-12-21(13-7-1)15-17-14-16-8-2-4-10-19(16)22-20-11-5-3-9-18(17)20;5-3(6)1-2-4(7)8/h2*1-6,8-11,14H,7,12-13,15H2;1-2H,(H,5,6)(H,7,8) |
| InChIKey | ROEXIMBOWDANST-UHFFFAOYSA-N |
| XLogP | 8.90 |
| TPSA | 99.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 694.83 |
| LogP ≤ 5 | 8.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze bis(1-(benzo[b][1]benzoxepin-5-ylmethyl)-3,6-dihydro-2H-pyridine);but-2-enedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(1-(benzo[b][1]benzoxepin-5-ylmethyl)-3,6-dihydro-2H-pyridine);but-2-enedioic acid?
The IUPAC name of bis(1-(benzo[b][1]benzoxepin-5-ylmethyl)-3,6-dihydro-2H-pyridine);but-2-enedioic acid (CID 173328589) is bis(1-(benzo[b][1]benzoxepin-5-ylmethyl)-3,6-dihydro-2H-pyridine);but-2-enedioic acid.
What is the SMILES notation for bis(1-(benzo[b][1]benzoxepin-5-ylmethyl)-3,6-dihydro-2H-pyridine);but-2-enedioic acid?
The canonical SMILES for bis(1-(benzo[b][1]benzoxepin-5-ylmethyl)-3,6-dihydro-2H-pyridine);but-2-enedioic acid is C1=CCN(CC2=Cc3ccccc3Oc3ccccc32)CC1.C1=CCN(CC2=Cc3ccccc3Oc3ccccc32)CC1.O=C(O)C=CC(=O)O.
What is the InChIKey of bis(1-(benzo[b][1]benzoxepin-5-ylmethyl)-3,6-dihydro-2H-pyridine);but-2-enedioic acid?
The InChIKey is ROEXIMBOWDANST-UHFFFAOYSA-N. The full InChI is InChI=1S/2C20H19NO.C4H4O4/c2*1-6-12-21(13-7-1)15-17-14-16-8-2-4-10-19(16)22-20-11-5-3-9-18(17)20;5-3(6)1-2-4(7)8/h2*1-6,8-11,14H,7,12-13,15H2;1-2H,(H,5,6)(H,7,8).
What are the key properties of bis(1-(benzo[b][1]benzoxepin-5-ylmethyl)-3,6-dihydro-2H-pyridine);but-2-enedioic acid?
bis(1-(benzo[b][1]benzoxepin-5-ylmethyl)-3,6-dihydro-2H-pyridine);but-2-enedioic acid has a molecular weight of 694.83 g/mol, XLogP of 8.90, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(1-(benzo[b][1]benzoxepin-5-ylmethyl)-3,6-dihydro-2H-pyridine);but-2-enedioic acid is sourced from PubChem (CID 173328589), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).