About 1-cycloheptylethyl undecanoate
1-cycloheptylethyl undecanoate (PubChem CID 173328758) has the molecular formula C20H38O2
and a molecular weight of 310.52 g/mol. Its IUPAC name is 1-cycloheptylethyl undecanoate.
Molecular Properties
| Compound Name | 1-cycloheptylethyl undecanoate |
| PubChem CID | 173328758 |
| Molecular Formula | C20H38O2 |
| Molecular Weight | 310.52 g/mol |
| Exact Mass | 310.29 |
| IUPAC Name | 1-cycloheptylethyl undecanoate |
| SMILES | CCCCCCCCCCC(=O)OC(C)C1CCCCCC1 |
| InChI | InChI=1S/C20H38O2/c1-3-4-5-6-7-8-9-14-17-20(21)22-18(2)19-15-12-10-11-13-16-19/h18-19H,3-17H2,1-2H3 |
| InChIKey | FGRHUJQDRNRPNS-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 310.52 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-cycloheptylethyl undecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cycloheptylethyl undecanoate?
The IUPAC name of 1-cycloheptylethyl undecanoate (CID 173328758) is 1-cycloheptylethyl undecanoate.
What is the SMILES notation for 1-cycloheptylethyl undecanoate?
The canonical SMILES for 1-cycloheptylethyl undecanoate is CCCCCCCCCCC(=O)OC(C)C1CCCCCC1.
What is the InChIKey of 1-cycloheptylethyl undecanoate?
The InChIKey is FGRHUJQDRNRPNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H38O2/c1-3-4-5-6-7-8-9-14-17-20(21)22-18(2)19-15-12-10-11-13-16-19/h18-19H,3-17H2,1-2H3.
What are the key properties of 1-cycloheptylethyl undecanoate?
1-cycloheptylethyl undecanoate has a molecular weight of 310.52 g/mol, XLogP of 6.42, 11 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cycloheptylethyl undecanoate is sourced from PubChem (CID 173328758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).