C27H51ClN2O2 — CID 173329281
bis(dimethyl-bis(prop-2-enyl)azanium);2-propylideneoctanoate;chloride (PubChem CID 173329281) has the molecular formula C27H51ClN2O2 and a molecular weight of 471.17 g/mol. Its IUPAC name is bis(dimethyl-bis(prop-2-enyl)azanium);2-propylideneoctanoate;chloride.
| Compound Name | bis(dimethyl-bis(prop-2-enyl)azanium);2-propylideneoctanoate;chloride |
|---|---|
| PubChem CID | 173329281 |
| Molecular Formula | C27H51ClN2O2 |
| Molecular Weight | 471.17 g/mol |
| Exact Mass | 470.36 |
| IUPAC Name | bis(dimethyl-bis(prop-2-enyl)azanium);2-propylideneoctanoate;chloride |
| SMILES | C=CC[N+](C)(C)CC=C.C=CC[N+](C)(C)CC=C.CCC=C(CCCCCC)C(=O)[O-].[Cl-] |
| InChI | InChI=1S/C11H20O2.2C8H16N.ClH/c1-3-5-6-7-9-10(8-4-2)11(12)13;2*1-5-7-9(3,4)8-6-2;/h8H,3-7,9H2,1-2H3,(H,12,13);2*5-6H,1-2,7-8H2,3-4H3;1H/q;2*+1;/p-2 |
| InChIKey | AGDKYHIQEQDYGI-UHFFFAOYSA-L |
| XLogP | 1.92 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.17 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|