C20H17F5N4O4 — CID 173329479
2,3-diamino-3-(4-methanehydrazonoylphenyl)-4,7-dioxo-2-(2,3,4,5,6-pentafluorophenyl)heptanoic acid (PubChem CID 173329479) has the molecular formula C20H17F5N4O4 and a molecular weight of 472.37 g/mol. Its IUPAC name is 2,3-diamino-3-(4-methanehydrazonoylphenyl)-4,7-dioxo-2-(2,3,4,5,6-pentafluorophenyl)heptanoic acid.
| Compound Name | 2,3-diamino-3-(4-methanehydrazonoylphenyl)-4,7-dioxo-2-(2,3,4,5,6-pentafluorophenyl)heptanoic acid |
|---|---|
| PubChem CID | 173329479 |
| Molecular Formula | C20H17F5N4O4 |
| Molecular Weight | 472.37 g/mol |
| Exact Mass | 472.12 |
| IUPAC Name | 2,3-diamino-3-(4-methanehydrazonoylphenyl)-4,7-dioxo-2-(2,3,4,5,6-pentafluorophenyl)heptanoic acid |
| SMILES | NN=Cc1ccc(C(N)(C(=O)CCC=O)C(N)(C(=O)O)c2c(F)c(F)c(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C20H17F5N4O4/c21-13-12(14(22)16(24)17(25)15(13)23)20(27,18(32)33)19(26,11(31)2-1-7-30)10-5-3-9(4-6-10)8-29-28/h3-8H,1-2,26-28H2,(H,32,33) |
| InChIKey | AZGQQOIZXFUQID-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 161.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.37 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|