About potassium;acetic acid;boranuide
potassium;acetic acid;boranuide (PubChem CID 173329515) has the molecular formula C2H8BKO2
and a molecular weight of 113.99 g/mol. Its IUPAC name is potassium;acetic acid;boranuide.
Molecular Properties
| Compound Name | potassium;acetic acid;boranuide |
| PubChem CID | 173329515 |
| Molecular Formula | C2H8BKO2 |
| Molecular Weight | 113.99 g/mol |
| Exact Mass | 114.03 |
| IUPAC Name | potassium;acetic acid;boranuide |
| SMILES | CC(=O)O.[BH4-].[K+] |
| InChI | InChI=1S/C2H4O2.BH4.K/c1-2(3)4;;/h1H3,(H,3,4);1H4;/q;-1;+1 |
| InChIKey | ZMNYFIKMNUGMTC-UHFFFAOYSA-N |
| XLogP | -4.36 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 113.99 |
| LogP ≤ 5 | -4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze potassium;acetic acid;boranuide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;acetic acid;boranuide?
The IUPAC name of potassium;acetic acid;boranuide (CID 173329515) is potassium;acetic acid;boranuide.
What is the SMILES notation for potassium;acetic acid;boranuide?
The canonical SMILES for potassium;acetic acid;boranuide is CC(=O)O.[BH4-].[K+].
What is the InChIKey of potassium;acetic acid;boranuide?
The InChIKey is ZMNYFIKMNUGMTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H4O2.BH4.K/c1-2(3)4;;/h1H3,(H,3,4);1H4;/q;-1;+1.
What are the key properties of potassium;acetic acid;boranuide?
potassium;acetic acid;boranuide has a molecular weight of 113.99 g/mol, XLogP of -4.36, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;acetic acid;boranuide is sourced from PubChem (CID 173329515), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).