C36H52NO4S4+ — CID 173329780
N-[4-[[2,6-bis(tert-butylsulfanyl)pyrylium-4-yl]methylidene]-2-[(2,6-ditert-butylthiopyran-4-ylidene)methyl]-3-oxocyclobuten-1-yl]butane-2-sulfonamide (PubChem CID 173329780) has the molecular formula C36H52NO4S4+ and a molecular weight of 691.08 g/mol. Its IUPAC name is N-[4-[[2,6-bis(tert-butylsulfanyl)pyrylium-4-yl]methylidene]-2-[(2,6-ditert-butylthiopyran-4-ylidene)methyl]-3-oxocyclobuten-1-yl]butane-2-sulfonamide.
| Compound Name | N-[4-[[2,6-bis(tert-butylsulfanyl)pyrylium-4-yl]methylidene]-2-[(2,6-ditert-butylthiopyran-4-ylidene)methyl]-3-oxocyclobuten-1-yl]butane-2-sulfonamide |
|---|---|
| PubChem CID | 173329780 |
| Molecular Formula | C36H52NO4S4+ |
| Molecular Weight | 691.08 g/mol |
| Exact Mass | 690.28 |
| IUPAC Name | N-[4-[[2,6-bis(tert-butylsulfanyl)pyrylium-4-yl]methylidene]-2-[(2,6-ditert-butylthiopyran-4-ylidene)methyl]-3-oxocyclobuten-1-yl]butane-2-sulfonamide |
| SMILES | CCC(C)S(=O)(=O)NC1=C(C=C2C=C(C(C)(C)C)SC(C(C)(C)C)=C2)C(=O)C1=Cc1cc(SC(C)(C)C)[o+]c(SC(C)(C)C)c1 |
| InChI | InChI=1S/C36H51NO4S4/c1-15-22(2)45(39,40)37-31-25(16-23-18-27(33(3,4)5)42-28(19-23)34(6,7)8)32(38)26(31)17-24-20-29(43-35(9,10)11)41-30(21-24)44-36(12,13)14/h16-22H,15H2,1-14H3/p+1 |
| InChIKey | PXZFIILHFQHFGB-UHFFFAOYSA-O |
| XLogP | 10.81 |
| TPSA | 74.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.08 |
| LogP ≤ 5 | 10.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|