C21H34 — CID 173330052
(5R,8R,9R,10S,13R,14S,17R)-17-ethenyl-13-ethyl-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthrene (PubChem CID 173330052) has the molecular formula C21H34 and a molecular weight of 286.50 g/mol. Its IUPAC name is (5R,8R,9R,10S,13R,14S,17R)-17-ethenyl-13-ethyl-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthrene.
| Compound Name | (5R,8R,9R,10S,13R,14S,17R)-17-ethenyl-13-ethyl-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 173330052 |
| Molecular Formula | C21H34 |
| Molecular Weight | 286.50 g/mol |
| Exact Mass | 286.27 |
| IUPAC Name | (5R,8R,9R,10S,13R,14S,17R)-17-ethenyl-13-ethyl-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthrene |
| SMILES | C=C[C@H]1CC[C@H]2[C@@H]3CC[C@H]4CCCC[C@@H]4[C@H]3CC[C@]12CC |
| InChI | InChI=1S/C21H34/c1-3-16-10-12-20-19-11-9-15-7-5-6-8-17(15)18(19)13-14-21(16,20)4-2/h3,15-20H,1,4-14H2,2H3/t15-,16+,17+,18-,19-,20+,21-/m1/s1 |
| InChIKey | QKUZTTIZVHHNAD-MZLRYNDKSA-N |
| XLogP | 6.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.50 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|