C21H23FN4O5 — CID 173330220
2,3-diamino-2-(4-fluorophenyl)-3-[hydroxy-(4-methanehydrazonoylphenyl)methyl]-4,7-dioxoheptanoic acid (PubChem CID 173330220) has the molecular formula C21H23FN4O5 and a molecular weight of 430.44 g/mol. Its IUPAC name is 2,3-diamino-2-(4-fluorophenyl)-3-[hydroxy-(4-methanehydrazonoylphenyl)methyl]-4,7-dioxoheptanoic acid.
| Compound Name | 2,3-diamino-2-(4-fluorophenyl)-3-[hydroxy-(4-methanehydrazonoylphenyl)methyl]-4,7-dioxoheptanoic acid |
|---|---|
| PubChem CID | 173330220 |
| Molecular Formula | C21H23FN4O5 |
| Molecular Weight | 430.44 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | 2,3-diamino-2-(4-fluorophenyl)-3-[hydroxy-(4-methanehydrazonoylphenyl)methyl]-4,7-dioxoheptanoic acid |
| SMILES | NN=Cc1ccc(C(O)C(N)(C(=O)CCC=O)C(N)(C(=O)O)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C21H23FN4O5/c22-16-9-7-15(8-10-16)20(23,19(30)31)21(24,17(28)2-1-11-27)18(29)14-5-3-13(4-6-14)12-26-25/h3-12,18,29H,1-2,23-25H2,(H,30,31) |
| InChIKey | CWKBAMJSQZNZRV-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 182.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.44 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|