C21H42O3Si — CID 173330565
1-[tert-butyl(dimethyl)silyl]oxy-1-(3,7-dimethylocta-2,6-dienoxy)pentan-2-ol (PubChem CID 173330565) has the molecular formula C21H42O3Si and a molecular weight of 370.65 g/mol. Its IUPAC name is 1-[tert-butyl(dimethyl)silyl]oxy-1-(3,7-dimethylocta-2,6-dienoxy)pentan-2-ol.
| Compound Name | 1-[tert-butyl(dimethyl)silyl]oxy-1-(3,7-dimethylocta-2,6-dienoxy)pentan-2-ol |
|---|---|
| PubChem CID | 173330565 |
| Molecular Formula | C21H42O3Si |
| Molecular Weight | 370.65 g/mol |
| Exact Mass | 370.29 |
| IUPAC Name | 1-[tert-butyl(dimethyl)silyl]oxy-1-(3,7-dimethylocta-2,6-dienoxy)pentan-2-ol |
| SMILES | CCCC(O)C(OCC=C(C)CCC=C(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H42O3Si/c1-10-12-19(22)20(24-25(8,9)21(5,6)7)23-16-15-18(4)14-11-13-17(2)3/h13,15,19-20,22H,10-12,14,16H2,1-9H3 |
| InChIKey | KHVVPOKINBIQEW-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.65 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|