C14H21N3O2 — CID 173331162
4-nona-4,6-dien-3-yl-6-oxo-4,5-dihydro-1H-pyridazine-3-carboxamide (PubChem CID 173331162) has the molecular formula C14H21N3O2 and a molecular weight of 263.34 g/mol. Its IUPAC name is 4-nona-4,6-dien-3-yl-6-oxo-4,5-dihydro-1H-pyridazine-3-carboxamide.
| Compound Name | 4-nona-4,6-dien-3-yl-6-oxo-4,5-dihydro-1H-pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 173331162 |
| Molecular Formula | C14H21N3O2 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.16 |
| IUPAC Name | 4-nona-4,6-dien-3-yl-6-oxo-4,5-dihydro-1H-pyridazine-3-carboxamide |
| SMILES | CCC=CC=CC(CC)C1CC(=O)NN=C1C(N)=O |
| InChI | InChI=1S/C14H21N3O2/c1-3-5-6-7-8-10(4-2)11-9-12(18)16-17-13(11)14(15)19/h5-8,10-11H,3-4,9H2,1-2H3,(H2,15,19)(H,16,18) |
| InChIKey | CFBSJQDDSWTYDU-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 84.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|