About 1-(4-methyl-2H-1,3-thiazol-3-yl)propan-2-ol;dihydrochloride
1-(4-methyl-2H-1,3-thiazol-3-yl)propan-2-ol;dihydrochloride (PubChem CID 173331337) has the molecular formula C7H15Cl2NOS
and a molecular weight of 232.18 g/mol. Its IUPAC name is 1-(4-methyl-2H-1,3-thiazol-3-yl)propan-2-ol;dihydrochloride.
Molecular Properties
| Compound Name | 1-(4-methyl-2H-1,3-thiazol-3-yl)propan-2-ol;dihydrochloride |
| PubChem CID | 173331337 |
| Molecular Formula | C7H15Cl2NOS |
| Molecular Weight | 232.18 g/mol |
| Exact Mass | 231.03 |
| IUPAC Name | 1-(4-methyl-2H-1,3-thiazol-3-yl)propan-2-ol;dihydrochloride |
| SMILES | CC1=CSCN1CC(C)O.Cl.Cl |
| InChI | InChI=1S/C7H13NOS.2ClH/c1-6-4-10-5-8(6)3-7(2)9;;/h4,7,9H,3,5H2,1-2H3;2*1H |
| InChIKey | ZJYQFXUSWYKAKP-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.18 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(4-methyl-2H-1,3-thiazol-3-yl)propan-2-ol;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-methyl-2H-1,3-thiazol-3-yl)propan-2-ol;dihydrochloride?
The IUPAC name of 1-(4-methyl-2H-1,3-thiazol-3-yl)propan-2-ol;dihydrochloride (CID 173331337) is 1-(4-methyl-2H-1,3-thiazol-3-yl)propan-2-ol;dihydrochloride.
What is the SMILES notation for 1-(4-methyl-2H-1,3-thiazol-3-yl)propan-2-ol;dihydrochloride?
The canonical SMILES for 1-(4-methyl-2H-1,3-thiazol-3-yl)propan-2-ol;dihydrochloride is CC1=CSCN1CC(C)O.Cl.Cl.
What is the InChIKey of 1-(4-methyl-2H-1,3-thiazol-3-yl)propan-2-ol;dihydrochloride?
The InChIKey is ZJYQFXUSWYKAKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NOS.2ClH/c1-6-4-10-5-8(6)3-7(2)9;;/h4,7,9H,3,5H2,1-2H3;2*1H.
What are the key properties of 1-(4-methyl-2H-1,3-thiazol-3-yl)propan-2-ol;dihydrochloride?
1-(4-methyl-2H-1,3-thiazol-3-yl)propan-2-ol;dihydrochloride has a molecular weight of 232.18 g/mol, XLogP of 2.08, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-methyl-2H-1,3-thiazol-3-yl)propan-2-ol;dihydrochloride is sourced from PubChem (CID 173331337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).