C24H32N6O4 — CID 173331434
7-[[2-[4-(cyclohexylmethyl)piperazin-1-yl]-2-oxoethoxy]iminomethyl]-1,3-dihydroimidazo[4,5-b]quinolin-2-one;hydrate (PubChem CID 173331434) has the molecular formula C24H32N6O4 and a molecular weight of 468.56 g/mol. Its IUPAC name is 7-[[2-[4-(cyclohexylmethyl)piperazin-1-yl]-2-oxoethoxy]iminomethyl]-1,3-dihydroimidazo[4,5-b]quinolin-2-one;hydrate.
| Compound Name | 7-[[2-[4-(cyclohexylmethyl)piperazin-1-yl]-2-oxoethoxy]iminomethyl]-1,3-dihydroimidazo[4,5-b]quinolin-2-one;hydrate |
|---|---|
| PubChem CID | 173331434 |
| Molecular Formula | C24H32N6O4 |
| Molecular Weight | 468.56 g/mol |
| Exact Mass | 468.25 |
| IUPAC Name | 7-[[2-[4-(cyclohexylmethyl)piperazin-1-yl]-2-oxoethoxy]iminomethyl]-1,3-dihydroimidazo[4,5-b]quinolin-2-one;hydrate |
| SMILES | O.O=C(CON=Cc1ccc2nc3[nH]c(=O)[nH]c3cc2c1)N1CCN(CC2CCCCC2)CC1 |
| InChI | InChI=1S/C24H30N6O3.H2O/c31-22(30-10-8-29(9-11-30)15-17-4-2-1-3-5-17)16-33-25-14-18-6-7-20-19(12-18)13-21-23(26-20)28-24(32)27-21;/h6-7,12-14,17H,1-5,8-11,15-16H2,(H2,26,27,28,32);1H2 |
| InChIKey | FTFZUZQANZQQBJ-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 138.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.56 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|