C25H41K2NO5 — CID 173332127
CID 173332127 (PubChem CID 173332127) has the molecular formula C25H41K2NO5 and a molecular weight of 513.80 g/mol.
| Compound Name | CID 173332127 |
|---|---|
| PubChem CID | 173332127 |
| Molecular Formula | C25H41K2NO5 |
| Molecular Weight | 513.80 g/mol |
| Exact Mass | 513.23 |
| IUPAC Name | — |
| SMILES | CCCCCCCCN(CCCCCCCC)OC(C(=O)O)(C(=O)O)c1ccccc1.[K].[K] |
| InChI | InChI=1S/C25H41NO5.2K/c1-3-5-7-9-11-16-20-26(21-17-12-10-8-6-4-2)31-25(23(27)28,24(29)30)22-18-14-13-15-19-22;;/h13-15,18-19H,3-12,16-17,20-21H2,1-2H3,(H,27,28)(H,29,30);; |
| InChIKey | PHLGQDALKXCXBN-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.80 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|