C30H102O9Si21 — CID 173332438
1,1-bis[tris(trimethylsilylsilyloxy)silyl]prop-1-en-2-yl-tris(trimethylsilylsilyloxy)silane (PubChem CID 173332438) has the molecular formula C30H102O9Si21 and a molecular weight of 1196.94 g/mol. Its IUPAC name is 1,1-bis[tris(trimethylsilylsilyloxy)silyl]prop-1-en-2-yl-tris(trimethylsilylsilyloxy)silane.
| Compound Name | 1,1-bis[tris(trimethylsilylsilyloxy)silyl]prop-1-en-2-yl-tris(trimethylsilylsilyloxy)silane |
|---|---|
| PubChem CID | 173332438 |
| Molecular Formula | C30H102O9Si21 |
| Molecular Weight | 1196.94 g/mol |
| Exact Mass | 1194.27 |
| IUPAC Name | 1,1-bis[tris(trimethylsilylsilyloxy)silyl]prop-1-en-2-yl-tris(trimethylsilylsilyloxy)silane |
| SMILES | CC(=C([Si](O[SiH2][Si](C)(C)C)(O[SiH2][Si](C)(C)C)O[SiH2][Si](C)(C)C)[Si](O[SiH2][Si](C)(C)C)(O[SiH2][Si](C)(C)C)O[SiH2][Si](C)(C)C)[Si](O[SiH2][Si](C)(C)C)(O[SiH2][Si](C)(C)C)O[SiH2][Si](C)(C)C |
| InChI | InChI=1S/C30H102O9Si21/c1-29(58(31-40-49(2,3)4,32-41-50(5,6)7)33-42-51(8,9)10)30(59(34-43-52(11,12)13,35-44-53(14,15)16)36-45-54(17,18)19)60(37-46-55(20,21)22,38-47-56(23,24)25)39-48-57(26,27)28/h40-48H2,1-28H3 |
| InChIKey | PINYHIMMOODXRJ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 83.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 60 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 1196.94 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|