About 3-[[6,6-dimethylhept-2-en-4-ynyl(ethyl)amino]methyl]-N-ethylaniline
3-[[6,6-dimethylhept-2-en-4-ynyl(ethyl)amino]methyl]-N-ethylaniline (PubChem CID 173333304) has the molecular formula C20H30N2
and a molecular weight of 298.47 g/mol. Its IUPAC name is 3-[[6,6-dimethylhept-2-en-4-ynyl(ethyl)amino]methyl]-N-ethylaniline.
Molecular Properties
| Compound Name | 3-[[6,6-dimethylhept-2-en-4-ynyl(ethyl)amino]methyl]-N-ethylaniline |
| PubChem CID | 173333304 |
| Molecular Formula | C20H30N2 |
| Molecular Weight | 298.47 g/mol |
| Exact Mass | 298.24 |
| IUPAC Name | 3-[[6,6-dimethylhept-2-en-4-ynyl(ethyl)amino]methyl]-N-ethylaniline |
| SMILES | CCNc1cccc(CN(CC)CC=CC#CC(C)(C)C)c1 |
| InChI | InChI=1S/C20H30N2/c1-6-21-19-13-11-12-18(16-19)17-22(7-2)15-10-8-9-14-20(3,4)5/h8,10-13,16,21H,6-7,15,17H2,1-5H3 |
| InChIKey | AKWFOTZUFSSBRJ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.47 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-[[6,6-dimethylhept-2-en-4-ynyl(ethyl)amino]methyl]-N-ethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[6,6-dimethylhept-2-en-4-ynyl(ethyl)amino]methyl]-N-ethylaniline?
The IUPAC name of 3-[[6,6-dimethylhept-2-en-4-ynyl(ethyl)amino]methyl]-N-ethylaniline (CID 173333304) is 3-[[6,6-dimethylhept-2-en-4-ynyl(ethyl)amino]methyl]-N-ethylaniline.
What is the SMILES notation for 3-[[6,6-dimethylhept-2-en-4-ynyl(ethyl)amino]methyl]-N-ethylaniline?
The canonical SMILES for 3-[[6,6-dimethylhept-2-en-4-ynyl(ethyl)amino]methyl]-N-ethylaniline is CCNc1cccc(CN(CC)CC=CC#CC(C)(C)C)c1.
What is the InChIKey of 3-[[6,6-dimethylhept-2-en-4-ynyl(ethyl)amino]methyl]-N-ethylaniline?
The InChIKey is AKWFOTZUFSSBRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H30N2/c1-6-21-19-13-11-12-18(16-19)17-22(7-2)15-10-8-9-14-20(3,4)5/h8,10-13,16,21H,6-7,15,17H2,1-5H3.
What are the key properties of 3-[[6,6-dimethylhept-2-en-4-ynyl(ethyl)amino]methyl]-N-ethylaniline?
3-[[6,6-dimethylhept-2-en-4-ynyl(ethyl)amino]methyl]-N-ethylaniline has a molecular weight of 298.47 g/mol, XLogP of 4.55, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[6,6-dimethylhept-2-en-4-ynyl(ethyl)amino]methyl]-N-ethylaniline is sourced from PubChem (CID 173333304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).