C31H39Zr- — CID 173333548
2,7-ditert-butyl-1-(2-ethylcyclopenta-1,3-dien-1-yl)-9H-fluoren-9-ide;propan-2-ylidenezirconium (PubChem CID 173333548) has the molecular formula C31H39Zr- and a molecular weight of 502.88 g/mol. Its IUPAC name is 2,7-ditert-butyl-1-(2-ethylcyclopenta-1,3-dien-1-yl)-9H-fluoren-9-ide;propan-2-ylidenezirconium.
| Compound Name | 2,7-ditert-butyl-1-(2-ethylcyclopenta-1,3-dien-1-yl)-9H-fluoren-9-ide;propan-2-ylidenezirconium |
|---|---|
| PubChem CID | 173333548 |
| Molecular Formula | C31H39Zr- |
| Molecular Weight | 502.88 g/mol |
| Exact Mass | 501.21 |
| IUPAC Name | 2,7-ditert-butyl-1-(2-ethylcyclopenta-1,3-dien-1-yl)-9H-fluoren-9-ide;propan-2-ylidenezirconium |
| SMILES | CC(C)=[Zr].CCC1=C(c2c(C(C)(C)C)ccc3c2[cH-]c2cc(C(C)(C)C)ccc23)CC=C1 |
| InChI | InChI=1S/C28H33.C3H6.Zr/c1-8-18-10-9-11-22(18)26-24-17-19-16-20(27(2,3)4)12-13-21(19)23(24)14-15-25(26)28(5,6)7;1-3-2;/h9-10,12-17H,8,11H2,1-7H3;1-2H3;/q-1;; |
| InChIKey | PSUXZQBACXHWMN-UHFFFAOYSA-N |
| XLogP | 9.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.88 |
| LogP ≤ 5 | 9.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|