C18H32NO8P — CID 173333579
8-acetyloxy-4-(2,4-dimethyl-3-phosphonopentan-3-yl)-2-formamidooct-3-enoic acid (PubChem CID 173333579) has the molecular formula C18H32NO8P and a molecular weight of 421.43 g/mol. Its IUPAC name is 8-acetyloxy-4-(2,4-dimethyl-3-phosphonopentan-3-yl)-2-formamidooct-3-enoic acid.
| Compound Name | 8-acetyloxy-4-(2,4-dimethyl-3-phosphonopentan-3-yl)-2-formamidooct-3-enoic acid |
|---|---|
| PubChem CID | 173333579 |
| Molecular Formula | C18H32NO8P |
| Molecular Weight | 421.43 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | 8-acetyloxy-4-(2,4-dimethyl-3-phosphonopentan-3-yl)-2-formamidooct-3-enoic acid |
| SMILES | CC(=O)OCCCCC(=CC(NC=O)C(=O)O)C(C(C)C)(C(C)C)P(=O)(O)O |
| InChI | InChI=1S/C18H32NO8P/c1-12(2)18(13(3)4,28(24,25)26)15(8-6-7-9-27-14(5)21)10-16(17(22)23)19-11-20/h10-13,16H,6-9H2,1-5H3,(H,19,20)(H,22,23)(H2,24,25,26) |
| InChIKey | IXQCNQADIASGMS-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 150.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.43 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|